C7H11NO2 — CID 131846194
(3S,4R)-4-acetyl-3-ethylazetidin-2-one (PubChem CID 131846194) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (3S,4R)-4-acetyl-3-ethylazetidin-2-one.
| Compound Name | (3S,4R)-4-acetyl-3-ethylazetidin-2-one |
|---|---|
| PubChem CID | 131846194 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (3S,4R)-4-acetyl-3-ethylazetidin-2-one |
| SMILES | CC[C@@H]1C(=O)N[C@H]1C(C)=O |
| InChI | InChI=1S/C7H11NO2/c1-3-5-6(4(2)9)8-7(5)10/h5-6H,3H2,1-2H3,(H,8,10)/t5-,6-/m0/s1 |
| InChIKey | OBKZMIMJXXNXCM-WDSKDSINSA-N |
| XLogP | 0.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |