C8H12O2 — CID 141348046
3,4-diethylcyclobutane-1,2-dione (PubChem CID 141348046) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 3,4-diethylcyclobutane-1,2-dione.
| Compound Name | 3,4-diethylcyclobutane-1,2-dione |
|---|---|
| PubChem CID | 141348046 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3,4-diethylcyclobutane-1,2-dione |
| SMILES | CCC1C(=O)C(=O)C1CC |
| InChI | InChI=1S/C8H12O2/c1-3-5-6(4-2)8(10)7(5)9/h5-6H,3-4H2,1-2H3 |
| InChIKey | IYIAYYPBWIYISX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|