C19H22O9 — CID 130186744
3-[2-[4-[2-(4-ethyl-2,5-dioxooxolan-3-yl)ethyl]-2,5-dioxooxolan-3-yl]ethyl]-4-methyloxolane-2,5-dione (PubChem CID 130186744) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-[2-[4-[2-(4-ethyl-2,5-dioxooxolan-3-yl)ethyl]-2,5-dioxooxolan-3-yl]ethyl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[2-[4-[2-(4-ethyl-2,5-dioxooxolan-3-yl)ethyl]-2,5-dioxooxolan-3-yl]ethyl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 130186744 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-[2-[4-[2-(4-ethyl-2,5-dioxooxolan-3-yl)ethyl]-2,5-dioxooxolan-3-yl]ethyl]-4-methyloxolane-2,5-dione |
| SMILES | CCC1C(=O)OC(=O)C1CCC1C(=O)OC(=O)C1CCC1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C19H22O9/c1-3-9-11(17(23)27-15(9)21)6-7-13-12(18(24)28-19(13)25)5-4-10-8(2)14(20)26-16(10)22/h8-13H,3-7H2,1-2H3 |
| InChIKey | ZAYQLWLQNBPSMZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|