C14H22O5 — CID 89316639
butyl 2,2-dimethyl-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate (PubChem CID 89316639) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is butyl 2,2-dimethyl-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate.
| Compound Name | butyl 2,2-dimethyl-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate |
|---|---|
| PubChem CID | 89316639 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | butyl 2,2-dimethyl-3-(4-methyl-2,5-dioxooxolan-3-yl)propanoate |
| SMILES | CCCCOC(=O)C(C)(C)CC1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C14H22O5/c1-5-6-7-18-13(17)14(3,4)8-10-9(2)11(15)19-12(10)16/h9-10H,5-8H2,1-4H3 |
| InChIKey | NYWLDJSHAHFSPM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|