C13H18O6 — CID 88941780
3-(4-methyl-2,5-dioxooxolan-3-yl)propanoyl 2,2-dimethylpropanoate (PubChem CID 88941780) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3-(4-methyl-2,5-dioxooxolan-3-yl)propanoyl 2,2-dimethylpropanoate.
| Compound Name | 3-(4-methyl-2,5-dioxooxolan-3-yl)propanoyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88941780 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-(4-methyl-2,5-dioxooxolan-3-yl)propanoyl 2,2-dimethylpropanoate |
| SMILES | CC1C(=O)OC(=O)C1CCC(=O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H18O6/c1-7-8(11(16)19-10(7)15)5-6-9(14)18-12(17)13(2,3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | LQLMJWKAJSGOAK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|