C13H18O7 — CID 90935029
4-O-[3-(2,2-dimethylpropanoyloxy)-3-oxopropyl] 1-O-methyl but-2-enedioate (PubChem CID 90935029) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is 4-O-[3-(2,2-dimethylpropanoyloxy)-3-oxopropyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[3-(2,2-dimethylpropanoyloxy)-3-oxopropyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 90935029 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-O-[3-(2,2-dimethylpropanoyloxy)-3-oxopropyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCC(=O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H18O7/c1-13(2,3)12(17)20-11(16)7-8-19-10(15)6-5-9(14)18-4/h5-6H,7-8H2,1-4H3 |
| InChIKey | ZAFAVLIYAMXXEW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|