C9H12O5 — CID 88671103
(Z)-4-(2,2-dimethylpropanoyloxy)-4-oxobut-2-enoic acid (PubChem CID 88671103) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (Z)-4-(2,2-dimethylpropanoyloxy)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2,2-dimethylpropanoyloxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 88671103 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (Z)-4-(2,2-dimethylpropanoyloxy)-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)C(=O)OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H12O5/c1-9(2,3)8(13)14-7(12)5-4-6(10)11/h4-5H,1-3H3,(H,10,11)/b5-4- |
| InChIKey | APBCLLJNQFSFQX-PLNGDYQASA-N |
| XLogP | 0.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|