C9H13ClO4 — CID 175736574
4-(1-chloro-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid (PubChem CID 175736574) has the molecular formula C9H13ClO4 and a molecular weight of 220.65 g/mol. Its IUPAC name is 4-(1-chloro-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid.
| Compound Name | 4-(1-chloro-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 175736574 |
| Molecular Formula | C9H13ClO4 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-(1-chloro-2,2-dimethylpropoxy)-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)C(Cl)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C9H13ClO4/c1-9(2,3)8(10)14-7(13)5-4-6(11)12/h4-5,8H,1-3H3,(H,11,12) |
| InChIKey | IAWSREWSLJGZMC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|