C12H13F7O4 — CID 154327558
4-(4,4,5,5,6,6,6-heptafluoro-2,2-dimethylhexan-3-yl)oxy-4-oxobut-2-enoic acid (PubChem CID 154327558) has the molecular formula C12H13F7O4 and a molecular weight of 354.22 g/mol. Its IUPAC name is 4-(4,4,5,5,6,6,6-heptafluoro-2,2-dimethylhexan-3-yl)oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-(4,4,5,5,6,6,6-heptafluoro-2,2-dimethylhexan-3-yl)oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 154327558 |
| Molecular Formula | C12H13F7O4 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-(4,4,5,5,6,6,6-heptafluoro-2,2-dimethylhexan-3-yl)oxy-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)C(OC(=O)C=CC(=O)O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F7O4/c1-9(2,3)8(23-7(22)5-4-6(20)21)10(13,14)11(15,16)12(17,18)19/h4-5,8H,1-3H3,(H,20,21) |
| InChIKey | BDBAHXHGSMKTFU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|