C22H24F16O4 — CID 88614544
bis(4,4,5,5,6,6,7,7-octafluoro-2,2-dimethylheptan-3-yl) (E)-but-2-enedioate (PubChem CID 88614544) has the molecular formula C22H24F16O4 and a molecular weight of 656.40 g/mol. Its IUPAC name is bis(4,4,5,5,6,6,7,7-octafluoro-2,2-dimethylheptan-3-yl) (E)-but-2-enedioate.
| Compound Name | bis(4,4,5,5,6,6,7,7-octafluoro-2,2-dimethylheptan-3-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88614544 |
| Molecular Formula | C22H24F16O4 |
| Molecular Weight | 656.40 g/mol |
| Exact Mass | 656.14 |
| IUPAC Name | bis(4,4,5,5,6,6,7,7-octafluoro-2,2-dimethylheptan-3-yl) (E)-but-2-enedioate |
| SMILES | CC(C)(C)C(OC(=O)/C=C/C(=O)OC(C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C22H24F16O4/c1-15(2,3)11(17(27,28)21(35,36)19(31,32)13(23)24)41-9(39)7-8-10(40)42-12(16(4,5)6)18(29,30)22(37,38)20(33,34)14(25)26/h7-8,11-14H,1-6H3/b8-7+ |
| InChIKey | GMSSOPQAXYWFGM-BQYQJAHWSA-N |
| XLogP | 7.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.40 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|