C15H16F8O4 — CID 54372941
4-(1-cyclohexyl-2,2,3,3,4,4,5,5-octafluoropentoxy)-4-oxobut-2-enoic acid (PubChem CID 54372941) has the molecular formula C15H16F8O4 and a molecular weight of 412.27 g/mol. Its IUPAC name is 4-(1-cyclohexyl-2,2,3,3,4,4,5,5-octafluoropentoxy)-4-oxobut-2-enoic acid.
| Compound Name | 4-(1-cyclohexyl-2,2,3,3,4,4,5,5-octafluoropentoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54372941 |
| Molecular Formula | C15H16F8O4 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-(1-cyclohexyl-2,2,3,3,4,4,5,5-octafluoropentoxy)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)OC(C1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H16F8O4/c16-12(17)14(20,21)15(22,23)13(18,19)11(8-4-2-1-3-5-8)27-10(26)7-6-9(24)25/h6-8,11-12H,1-5H2,(H,24,25) |
| InChIKey | UUMIKRWXWLRLBT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|