C13H16F4O4 — CID 88614855
(E)-4-(3-cyclohexyl-2,2,3,3-tetrafluoropropoxy)-4-oxobut-2-enoic acid (PubChem CID 88614855) has the molecular formula C13H16F4O4 and a molecular weight of 312.26 g/mol. Its IUPAC name is (E)-4-(3-cyclohexyl-2,2,3,3-tetrafluoropropoxy)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(3-cyclohexyl-2,2,3,3-tetrafluoropropoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 88614855 |
| Molecular Formula | C13H16F4O4 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (E)-4-(3-cyclohexyl-2,2,3,3-tetrafluoropropoxy)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OCC(F)(F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C13H16F4O4/c14-12(15,8-21-11(20)7-6-10(18)19)13(16,17)9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H,18,19)/b7-6+ |
| InChIKey | YXTWZOBHVLCWNC-VOTSOKGWSA-N |
| XLogP | 3.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|