C10H11F5O4 — CID 139640262
(Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxybut-2-enoic acid (PubChem CID 139640262) has the molecular formula C10H11F5O4 and a molecular weight of 290.18 g/mol. Its IUPAC name is (Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxybut-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxybut-2-enoic acid |
|---|---|
| PubChem CID | 139640262 |
| Molecular Formula | C10H11F5O4 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-4-methylpentan-3-yl)oxybut-2-enoic acid |
| SMILES | CC(C)C(OC(=O)/C=C\C(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F5O4/c1-5(2)8(9(11,12)10(13,14)15)19-7(18)4-3-6(16)17/h3-5,8H,1-2H3,(H,16,17)/b4-3- |
| InChIKey | QPDZGVKFSBRKRY-ARJAWSKDSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|