C9H8F8O2 — CID 141084105
(1,1,1,2,2,5,5,5-octafluoro-4-methylpentan-3-yl) prop-2-enoate (PubChem CID 141084105) has the molecular formula C9H8F8O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is (1,1,1,2,2,5,5,5-octafluoro-4-methylpentan-3-yl) prop-2-enoate.
| Compound Name | (1,1,1,2,2,5,5,5-octafluoro-4-methylpentan-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 141084105 |
| Molecular Formula | C9H8F8O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (1,1,1,2,2,5,5,5-octafluoro-4-methylpentan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(C(C)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F8O2/c1-3-5(18)19-6(4(2)8(12,13)14)7(10,11)9(15,16)17/h3-4,6H,1H2,2H3 |
| InChIKey | FTMLFPKHEZCCOP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|