C9H4F12O2 — CID 87803092
[1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl] prop-2-enoate (PubChem CID 87803092) has the molecular formula C9H4F12O2 and a molecular weight of 372.11 g/mol. Its IUPAC name is [1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl] prop-2-enoate.
| Compound Name | [1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 87803092 |
| Molecular Formula | C9H4F12O2 |
| Molecular Weight | 372.11 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | [1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4F12O2/c1-2-3(22)23-4(6(11,12)9(19,20)21)5(10,7(13,14)15)8(16,17)18/h2,4H,1H2 |
| InChIKey | HTAALTUYMKUQBM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.11 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|