C6H4F6O3 — CID 139981517
[2,2,2-trifluoro-1-(trifluoromethoxy)ethyl] prop-2-enoate (PubChem CID 139981517) has the molecular formula C6H4F6O3 and a molecular weight of 238.08 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-(trifluoromethoxy)ethyl] prop-2-enoate.
| Compound Name | [2,2,2-trifluoro-1-(trifluoromethoxy)ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 139981517 |
| Molecular Formula | C6H4F6O3 |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | [2,2,2-trifluoro-1-(trifluoromethoxy)ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F6O3/c1-2-3(13)14-4(5(7,8)9)15-6(10,11)12/h2,4H,1H2 |
| InChIKey | OZMQSXSAMSQLDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|