C7H7F3O4 — CID 19366626
(1-acetyloxy-2,2,2-trifluoroethyl) prop-2-enoate (PubChem CID 19366626) has the molecular formula C7H7F3O4 and a molecular weight of 212.12 g/mol. Its IUPAC name is (1-acetyloxy-2,2,2-trifluoroethyl) prop-2-enoate.
| Compound Name | (1-acetyloxy-2,2,2-trifluoroethyl) prop-2-enoate |
|---|---|
| PubChem CID | 19366626 |
| Molecular Formula | C7H7F3O4 |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | (1-acetyloxy-2,2,2-trifluoroethyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(OC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C7H7F3O4/c1-3-5(12)14-6(7(8,9)10)13-4(2)11/h3,6H,1H2,2H3 |
| InChIKey | GOHAWFOVDAJZDE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|