C8H9F5O3 — CID 58995488
(3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl) prop-2-enoate (PubChem CID 58995488) has the molecular formula C8H9F5O3 and a molecular weight of 248.15 g/mol. Its IUPAC name is (3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl) prop-2-enoate.
| Compound Name | (3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 58995488 |
| Molecular Formula | C8H9F5O3 |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (3,3,5,5,5-pentafluoro-4-hydroxypentan-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C8H9F5O3/c1-3-5(14)16-4(2)7(9,10)6(15)8(11,12)13/h3-4,6,15H,1H2,2H3 |
| InChIKey | LMVLVQJGCAXBMZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|