(Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid

C6H5F3O4 — CID 174546881

IUPAC(Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid
SMILESO=C(O)/C=C\C(=O)OC(F)C(F)F
InChIInChI=1S/C6H5F3O4/c7-5(8)6(9)13-4(12)2-1-3(10)11/h1-2,5-6H,(H,10,11)/b2-1-
InChIKeyMACYAKWGGNZGNC-UPHRSURJSA-N
MW198.10 g/mol
LogP0.73
Rot. Bonds4

About (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid

(Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid (PubChem CID 174546881) has the molecular formula C6H5F3O4 and a molecular weight of 198.10 g/mol. Its IUPAC name is (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid
PubChem CID174546881
Molecular FormulaC6H5F3O4
Molecular Weight198.10 g/mol
Exact Mass198.01
IUPAC Name(Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid
SMILESO=C(O)/C=C\C(=O)OC(F)C(F)F
InChIInChI=1S/C6H5F3O4/c7-5(8)6(9)13-4(12)2-1-3(10)11/h1-2,5-6H,(H,10,11)/b2-1-
InChIKeyMACYAKWGGNZGNC-UPHRSURJSA-N
XLogP0.73
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.10
LogP ≤ 50.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid?
The IUPAC name of (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid (CID 174546881) is (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid.
What is the SMILES notation for (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid?
The canonical SMILES for (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid is O=C(O)/C=C\C(=O)OC(F)C(F)F.
What is the InChIKey of (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid?
The InChIKey is MACYAKWGGNZGNC-UPHRSURJSA-N. The full InChI is InChI=1S/C6H5F3O4/c7-5(8)6(9)13-4(12)2-1-3(10)11/h1-2,5-6H,(H,10,11)/b2-1-.
What are the key properties of (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid?
(Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid has a molecular weight of 198.10 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-oxo-4-(1,2,2-trifluoroethoxy)but-2-enoic acid is sourced from PubChem (CID 174546881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).