About (Z)-but-2-enedioic acid;dioxotitanium
(Z)-but-2-enedioic acid;dioxotitanium (PubChem CID 174893866) has the molecular formula C4H4O6Ti
and a molecular weight of 195.94 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;dioxotitanium.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;dioxotitanium |
| PubChem CID | 174893866 |
| Molecular Formula | C4H4O6Ti |
| Molecular Weight | 195.94 g/mol |
| Exact Mass | 195.95 |
| IUPAC Name | (Z)-but-2-enedioic acid;dioxotitanium |
| SMILES | O=C(O)/C=C\C(=O)O.O=[Ti]=O |
| InChI | InChI=1S/C4H4O4.2O.Ti/c5-3(6)1-2-4(7)8;;;/h1-2H,(H,5,6)(H,7,8);;;/b2-1-;;; |
| InChIKey | XHRIXZQDVZZLEF-GRHBHMESSA-N |
| XLogP | -0.53 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.94 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;dioxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;dioxotitanium?
The IUPAC name of (Z)-but-2-enedioic acid;dioxotitanium (CID 174893866) is (Z)-but-2-enedioic acid;dioxotitanium.
What is the SMILES notation for (Z)-but-2-enedioic acid;dioxotitanium?
The canonical SMILES for (Z)-but-2-enedioic acid;dioxotitanium is O=C(O)/C=C\C(=O)O.O=[Ti]=O.
What is the InChIKey of (Z)-but-2-enedioic acid;dioxotitanium?
The InChIKey is XHRIXZQDVZZLEF-GRHBHMESSA-N. The full InChI is InChI=1S/C4H4O4.2O.Ti/c5-3(6)1-2-4(7)8;;;/h1-2H,(H,5,6)(H,7,8);;;/b2-1-;;;.
What are the key properties of (Z)-but-2-enedioic acid;dioxotitanium?
(Z)-but-2-enedioic acid;dioxotitanium has a molecular weight of 195.94 g/mol, XLogP of -0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;dioxotitanium is sourced from PubChem (CID 174893866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).