C13H17F3O4 — CID 139640290
(Z)-4-oxo-4-[1-propan-2-yl-2-(trifluoromethyl)cyclopentyl]oxybut-2-enoic acid (PubChem CID 139640290) has the molecular formula C13H17F3O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is (Z)-4-oxo-4-[1-propan-2-yl-2-(trifluoromethyl)cyclopentyl]oxybut-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[1-propan-2-yl-2-(trifluoromethyl)cyclopentyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 139640290 |
| Molecular Formula | C13H17F3O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (Z)-4-oxo-4-[1-propan-2-yl-2-(trifluoromethyl)cyclopentyl]oxybut-2-enoic acid |
| SMILES | CC(C)C1(OC(=O)/C=C\C(=O)O)CCCC1C(F)(F)F |
| InChI | InChI=1S/C13H17F3O4/c1-8(2)12(20-11(19)6-5-10(17)18)7-3-4-9(12)13(14,15)16/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,18)/b6-5- |
| InChIKey | XARHACYQNUKFPJ-WAYWQWQTSA-N |
| XLogP | 2.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|