C12H15F3O4 — CID 139640297
(Z)-4-oxo-4-[1-propan-2-yl-3-(trifluoromethyl)cyclobutyl]oxybut-2-enoic acid (PubChem CID 139640297) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is (Z)-4-oxo-4-[1-propan-2-yl-3-(trifluoromethyl)cyclobutyl]oxybut-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[1-propan-2-yl-3-(trifluoromethyl)cyclobutyl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 139640297 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (Z)-4-oxo-4-[1-propan-2-yl-3-(trifluoromethyl)cyclobutyl]oxybut-2-enoic acid |
| SMILES | CC(C)C1(OC(=O)/C=C\C(=O)O)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H15F3O4/c1-7(2)11(5-8(6-11)12(13,14)15)19-10(18)4-3-9(16)17/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)/b4-3- |
| InChIKey | YAOJPOUYHXMAMW-ARJAWSKDSA-N |
| XLogP | 2.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|