C30H18F38O4 — CID 87227858
bis(3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-nonadecafluoro-2-methyldodecan-3-yl) (E)-but-2-enedioate (PubChem CID 87227858) has the molecular formula C30H18F38O4 and a molecular weight of 1164.39 g/mol. Its IUPAC name is bis(3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-nonadecafluoro-2-methyldodecan-3-yl) (E)-but-2-enedioate.
| Compound Name | bis(3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-nonadecafluoro-2-methyldodecan-3-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87227858 |
| Molecular Formula | C30H18F38O4 |
| Molecular Weight | 1164.39 g/mol |
| Exact Mass | 1164.06 |
| IUPAC Name | bis(3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-nonadecafluoro-2-methyldodecan-3-yl) (E)-but-2-enedioate |
| SMILES | CC(C)C(F)(OC(=O)/C=C/C(=O)OC(F)(C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C30H18F38O4/c1-7(2)15(39,19(45,46)23(53,54)27(61,62)29(65,66)25(57,58)21(49,50)17(41,42)13(35,36)11(31)32)71-9(69)5-6-10(70)72-16(40,8(3)4)20(47,48)24(55,56)28(63,64)30(67,68)26(59,60)22(51,52)18(43,44)14(37,38)12(33)34/h5-8,11-12H,1-4H3/b6-5+ |
| InChIKey | BODCJBFWISCTIT-AATRIKPKSA-N |
| XLogP | 13.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.39 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|