C15H20F6O4 — CID 19766525
4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) 1-O-octyl (E)-but-2-enedioate (PubChem CID 19766525) has the molecular formula C15H20F6O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) 1-O-octyl (E)-but-2-enedioate.
| Compound Name | 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) 1-O-octyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 19766525 |
| Molecular Formula | C15H20F6O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-O-(1,1,1,2,3,3-hexafluoropropan-2-yl) 1-O-octyl (E)-but-2-enedioate |
| SMILES | CCCCCCCCOC(=O)/C=C/C(=O)OC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O4/c1-2-3-4-5-6-7-10-24-11(22)8-9-12(23)25-14(18,13(16)17)15(19,20)21/h8-9,13H,2-7,10H2,1H3/b9-8+ |
| InChIKey | WGLQTBGMKCJRFO-CMDGGOBGSA-N |
| XLogP | 4.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|