C12H15F5O4 — CID 139640295
(Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-3,4,4-trimethylpentan-3-yl)oxybut-2-enoic acid (PubChem CID 139640295) has the molecular formula C12H15F5O4 and a molecular weight of 318.24 g/mol. Its IUPAC name is (Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-3,4,4-trimethylpentan-3-yl)oxybut-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-3,4,4-trimethylpentan-3-yl)oxybut-2-enoic acid |
|---|---|
| PubChem CID | 139640295 |
| Molecular Formula | C12H15F5O4 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (Z)-4-oxo-4-(1,1,1,2,2-pentafluoro-3,4,4-trimethylpentan-3-yl)oxybut-2-enoic acid |
| SMILES | CC(C)(C)C(C)(OC(=O)/C=C\C(=O)O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F5O4/c1-9(2,3)10(4,11(13,14)12(15,16)17)21-8(20)6-5-7(18)19/h5-6H,1-4H3,(H,18,19)/b6-5- |
| InChIKey | NYTAUVIYSSKPCX-WAYWQWQTSA-N |
| XLogP | 3.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|