C12H10O10 — CID 123873468
4-[4-(3-carboxyprop-2-enoyloxy)-4-oxobutanoyl]oxy-4-oxobut-2-enoic acid (PubChem CID 123873468) has the molecular formula C12H10O10 and a molecular weight of 314.20 g/mol. Its IUPAC name is 4-[4-(3-carboxyprop-2-enoyloxy)-4-oxobutanoyl]oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[4-(3-carboxyprop-2-enoyloxy)-4-oxobutanoyl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 123873468 |
| Molecular Formula | C12H10O10 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-[4-(3-carboxyprop-2-enoyloxy)-4-oxobutanoyl]oxy-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)OC(=O)CCC(=O)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C12H10O10/c13-7(14)1-3-9(17)21-11(19)5-6-12(20)22-10(18)4-2-8(15)16/h1-4H,5-6H2,(H,13,14)(H,15,16) |
| InChIKey | BLJSBKFESCUIPI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|