About disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride
disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride (PubChem CID 174881927) has the molecular formula C12H20N2Na2O6
and a molecular weight of 334.28 g/mol. Its IUPAC name is disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride.
Molecular Properties
| Compound Name | disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride |
| PubChem CID | 174881927 |
| Molecular Formula | C12H20N2Na2O6 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride |
| SMILES | NCCCC(=O)OC(=O)/C=C/C(=O)OC(=O)CCCN.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C12H18N2O6.2Na.2H/c13-7-1-3-9(15)19-11(17)5-6-12(18)20-10(16)4-2-8-14;;;;/h5-6H,1-4,7-8,13-14H2;;;;/q;2*+1;2*-1/b6-5+;;;; |
| InChIKey | BKBRYFINDSCAMG-WPYDVODASA-N |
| XLogP | -6.61 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride?
The IUPAC name of disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride (CID 174881927) is disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride.
What is the SMILES notation for disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride?
The canonical SMILES for disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride is NCCCC(=O)OC(=O)/C=C/C(=O)OC(=O)CCCN.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride?
The InChIKey is BKBRYFINDSCAMG-WPYDVODASA-N. The full InChI is InChI=1S/C12H18N2O6.2Na.2H/c13-7-1-3-9(15)19-11(17)5-6-12(18)20-10(16)4-2-8-14;;;;/h5-6H,1-4,7-8,13-14H2;;;;/q;2*+1;2*-1/b6-5+;;;;.
What are the key properties of disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride?
disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride has a molecular weight of 334.28 g/mol, XLogP of -6.61, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;bis(4-aminobutanoyl) (E)-but-2-enedioate;hydride is sourced from PubChem (CID 174881927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).