About 4-aminobutaneperoxoic acid
4-aminobutaneperoxoic acid (PubChem CID 10887886) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 4-aminobutaneperoxoic acid.
Molecular Properties
| Compound Name | 4-aminobutaneperoxoic acid |
| PubChem CID | 10887886 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 4-aminobutaneperoxoic acid |
| SMILES | NCCCC(=O)OO |
| InChI | InChI=1S/C4H9NO3/c5-3-1-2-4(6)8-7/h7H,1-3,5H2 |
| InChIKey | UIIDIWSTMOYJBZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutaneperoxoic acid?
The IUPAC name of 4-aminobutaneperoxoic acid (CID 10887886) is 4-aminobutaneperoxoic acid.
What is the SMILES notation for 4-aminobutaneperoxoic acid?
The canonical SMILES for 4-aminobutaneperoxoic acid is NCCCC(=O)OO.
What is the InChIKey of 4-aminobutaneperoxoic acid?
The InChIKey is UIIDIWSTMOYJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c5-3-1-2-4(6)8-7/h7H,1-3,5H2.
What are the key properties of 4-aminobutaneperoxoic acid?
4-aminobutaneperoxoic acid has a molecular weight of 119.12 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutaneperoxoic acid is sourced from PubChem (CID 10887886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).