About 6-aminohexaneperoxoic acid
6-aminohexaneperoxoic acid (PubChem CID 22717715) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 6-aminohexaneperoxoic acid.
Molecular Properties
| Compound Name | 6-aminohexaneperoxoic acid |
| PubChem CID | 22717715 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 6-aminohexaneperoxoic acid |
| SMILES | NCCCCCC(=O)OO |
| InChI | InChI=1S/C6H13NO3/c7-5-3-1-2-4-6(8)10-9/h9H,1-5,7H2 |
| InChIKey | ITCICEGAURIGTM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-aminohexaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminohexaneperoxoic acid?
The IUPAC name of 6-aminohexaneperoxoic acid (CID 22717715) is 6-aminohexaneperoxoic acid.
What is the SMILES notation for 6-aminohexaneperoxoic acid?
The canonical SMILES for 6-aminohexaneperoxoic acid is NCCCCCC(=O)OO.
What is the InChIKey of 6-aminohexaneperoxoic acid?
The InChIKey is ITCICEGAURIGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c7-5-3-1-2-4-6(8)10-9/h9H,1-5,7H2.
What are the key properties of 6-aminohexaneperoxoic acid?
6-aminohexaneperoxoic acid has a molecular weight of 147.17 g/mol, XLogP of 0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminohexaneperoxoic acid is sourced from PubChem (CID 22717715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).