C8H8O8 — CID 174439023
4-[(Z)-3-carboxyprop-2-enoyl]oxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 174439023) has the molecular formula C8H8O8 and a molecular weight of 232.14 g/mol. Its IUPAC name is 4-[(Z)-3-carboxyprop-2-enoyl]oxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(Z)-3-carboxyprop-2-enoyl]oxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174439023 |
| Molecular Formula | C8H8O8 |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 4-[(Z)-3-carboxyprop-2-enoyl]oxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | O=C(O)/C=C\C(=O)OC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C8H8O8/c9-4(8(14)15)3-7(13)16-6(12)2-1-5(10)11/h1-2,4,9H,3H2,(H,10,11)(H,14,15)/b2-1- |
| InChIKey | HZUHYWTZNYAGCD-UPHRSURJSA-N |
| XLogP | -1.47 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|