C14H16O16 — CID 87673209
2-[2-[(Z)-3-carboxyprop-2-enoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid;2,3-dihydroxybutanedioic acid (PubChem CID 87673209) has the molecular formula C14H16O16 and a molecular weight of 440.27 g/mol. Its IUPAC name is 2-[2-[(Z)-3-carboxyprop-2-enoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-[2-[(Z)-3-carboxyprop-2-enoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 87673209 |
| Molecular Formula | C14H16O16 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[2-[(Z)-3-carboxyprop-2-enoyl]oxy-2-oxoethyl]-2-hydroxybutanedioic acid;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)/C=C\C(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H10O10.C4H6O6/c11-5(12)1-2-7(15)20-8(16)4-10(19,9(17)18)3-6(13)14;5-1(3(7)8)2(6)4(9)10/h1-2,19H,3-4H2,(H,11,12)(H,13,14)(H,17,18);1-2,5-6H,(H,7,8)(H,9,10)/b2-1-; |
| InChIKey | OIEQOZAYJYSXMI-ODZAUARKSA-N |
| XLogP | -3.75 |
| TPSA | 290.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|