C12H16O17 — CID 162198171
2,3-dihydroxybutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;oxalic acid (PubChem CID 162198171) has the molecular formula C12H16O17 and a molecular weight of 432.24 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;oxalic acid.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;oxalic acid |
|---|---|
| PubChem CID | 162198171 |
| Molecular Formula | C12H16O17 |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C4H6O6.C2H2O4/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-1(3(7)8)2(6)4(9)10;3-1(4)2(5)6/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2,5-6H,(H,7,8)(H,9,10);(H,3,4)(H,5,6) |
| InChIKey | ZRFOXNYUNAQKII-UHFFFAOYSA-N |
| XLogP | -4.22 |
| TPSA | 321.79 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|