C14H18O14 — CID 174459196
acetic acid;4-[4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 174459196) has the molecular formula C14H18O14 and a molecular weight of 410.28 g/mol. Its IUPAC name is acetic acid;4-[4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | acetic acid;4-[4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174459196 |
| Molecular Formula | C14H18O14 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | acetic acid;4-[4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | CC(=O)O.O=C(CCC(=O)OC(=O)CC(O)C(=O)O)OC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C12H14O12.C2H4O2/c13-5(11(19)20)3-9(17)23-7(15)1-2-8(16)24-10(18)4-6(14)12(21)22;1-2(3)4/h5-6,13-14H,1-4H2,(H,19,20)(H,21,22);1H3,(H,3,4) |
| InChIKey | RNKFHCFXKQGKIS-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 239.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|