C14H18O5 — CID 130310038
(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid (PubChem CID 130310038) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 130310038 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid |
| SMILES | C/C=C\C/C=C\CCCC(=O)OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H18O5/c1-2-3-4-5-6-7-8-9-13(17)19-14(18)11-10-12(15)16/h2-3,5-6,10-11H,4,7-9H2,1H3,(H,15,16)/b3-2-,6-5-,11-10+ |
| InChIKey | JRLKOJHUHOYGAA-INMDLIRGSA-N |
| XLogP | 2.39 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|