(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid

C14H18O5 — CID 130310038

IUPAC(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid
SMILESC/C=C\C/C=C\CCCC(=O)OC(=O)/C=C/C(=O)O
InChIInChI=1S/C14H18O5/c1-2-3-4-5-6-7-8-9-13(17)19-14(18)11-10-12(15)16/h2-3,5-6,10-11H,4,7-9H2,1H3,(H,15,16)/b3-2-,6-5-,11-10+
InChIKeyJRLKOJHUHOYGAA-INMDLIRGSA-N
MW266.29 g/mol
LogP2.39
Rot. Bonds8

About (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid

(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid (PubChem CID 130310038) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid
PubChem CID130310038
Molecular FormulaC14H18O5
Molecular Weight266.29 g/mol
Exact Mass266.12
IUPAC Name(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid
SMILESC/C=C\C/C=C\CCCC(=O)OC(=O)/C=C/C(=O)O
InChIInChI=1S/C14H18O5/c1-2-3-4-5-6-7-8-9-13(17)19-14(18)11-10-12(15)16/h2-3,5-6,10-11H,4,7-9H2,1H3,(H,15,16)/b3-2-,6-5-,11-10+
InChIKeyJRLKOJHUHOYGAA-INMDLIRGSA-N
XLogP2.39
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.29
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid (CID 130310038) is (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid is C/C=C\C/C=C\CCCC(=O)OC(=O)/C=C/C(=O)O.
What is the InChIKey of (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid?
The InChIKey is JRLKOJHUHOYGAA-INMDLIRGSA-N. The full InChI is InChI=1S/C14H18O5/c1-2-3-4-5-6-7-8-9-13(17)19-14(18)11-10-12(15)16/h2-3,5-6,10-11H,4,7-9H2,1H3,(H,15,16)/b3-2-,6-5-,11-10+.
What are the key properties of (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid?
(E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid has a molecular weight of 266.29 g/mol, XLogP of 2.39, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(5Z,8Z)-deca-5,8-dienoyl]oxy-4-oxobut-2-enoic acid is sourced from PubChem (CID 130310038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).