C16H24O7 — CID 90753854
4-O-[5-(3,3-dimethylbutanoyloxy)-5-oxopentyl] 1-O-methyl but-2-enedioate (PubChem CID 90753854) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-O-[5-(3,3-dimethylbutanoyloxy)-5-oxopentyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[5-(3,3-dimethylbutanoyloxy)-5-oxopentyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 90753854 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-O-[5-(3,3-dimethylbutanoyloxy)-5-oxopentyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCCCC(=O)OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H24O7/c1-16(2,3)11-15(20)23-14(19)7-5-6-10-22-13(18)9-8-12(17)21-4/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | CRIBVPVWYGYOJW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|