C18H19BrO7 — CID 90749240
4-O-[5-[2-(2-bromophenyl)acetyl]oxy-5-oxopentyl] 1-O-methyl but-2-enedioate (PubChem CID 90749240) has the molecular formula C18H19BrO7 and a molecular weight of 427.25 g/mol. Its IUPAC name is 4-O-[5-[2-(2-bromophenyl)acetyl]oxy-5-oxopentyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[5-[2-(2-bromophenyl)acetyl]oxy-5-oxopentyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 90749240 |
| Molecular Formula | C18H19BrO7 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 4-O-[5-[2-(2-bromophenyl)acetyl]oxy-5-oxopentyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCCCC(=O)OC(=O)Cc1ccccc1Br |
| InChI | InChI=1S/C18H19BrO7/c1-24-15(20)9-10-16(21)25-11-5-4-8-17(22)26-18(23)12-13-6-2-3-7-14(13)19/h2-3,6-7,9-10H,4-5,8,11-12H2,1H3 |
| InChIKey | YLNWYKBMXWWGMF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|