C24H39BrClNO2 — CID 6526575
[(E)-4-(2-bromophenyl)-3-methylbut-2-enyl]-diethyl-(2-heptoxy-2-oxoethyl)azanium chloride (PubChem CID 6526575) has the molecular formula C24H39BrClNO2 and a molecular weight of 488.94 g/mol. Its IUPAC name is [(E)-4-(2-bromophenyl)-3-methylbut-2-enyl]-diethyl-(2-heptoxy-2-oxoethyl)azanium chloride.
| Compound Name | [(E)-4-(2-bromophenyl)-3-methylbut-2-enyl]-diethyl-(2-heptoxy-2-oxoethyl)azanium chloride |
|---|---|
| PubChem CID | 6526575 |
| Molecular Formula | C24H39BrClNO2 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [(E)-4-(2-bromophenyl)-3-methylbut-2-enyl]-diethyl-(2-heptoxy-2-oxoethyl)azanium chloride |
| SMILES | CCCCCCCOC(=O)C[N+](CC)(CC)C/C=C(\C)Cc1ccccc1Br.[Cl-] |
| InChI | InChI=1S/C24H39BrNO2.ClH/c1-5-8-9-10-13-18-28-24(27)20-26(6-2,7-3)17-16-21(4)19-22-14-11-12-15-23(22)25;/h11-12,14-16H,5-10,13,17-20H2,1-4H3;1H/q+1;/p-1/b21-16+; |
| InChIKey | HTTLSJCWYKRQPF-JEBHESKQSA-M |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|