C25H39Cl2NO2 — CID 20840535
heptyl 2-[1-[(Z)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride (PubChem CID 20840535) has the molecular formula C25H39Cl2NO2 and a molecular weight of 456.50 g/mol. Its IUPAC name is heptyl 2-[1-[(Z)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride.
| Compound Name | heptyl 2-[1-[(Z)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride |
|---|---|
| PubChem CID | 20840535 |
| Molecular Formula | C25H39Cl2NO2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | heptyl 2-[1-[(Z)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate chloride |
| SMILES | CCCCCCCOC(=O)C[N+]1(C/C=C(/C)Cc2ccccc2Cl)CCCCC1.[Cl-] |
| InChI | InChI=1S/C25H39ClNO2.ClH/c1-3-4-5-6-12-19-29-25(28)21-27(16-10-7-11-17-27)18-15-22(2)20-23-13-8-9-14-24(23)26;/h8-9,13-15H,3-7,10-12,16-21H2,1-2H3;1H/q+1;/p-1/b22-15-; |
| InChIKey | PDRXYQLQCFBWEJ-YNYSCKANSA-M |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|