C22H33ClNO2+ — CID 6446606
butyl 2-[1-[(E)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate (PubChem CID 6446606) has the molecular formula C22H33ClNO2+ and a molecular weight of 378.96 g/mol. Its IUPAC name is butyl 2-[1-[(E)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate.
| Compound Name | butyl 2-[1-[(E)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 6446606 |
| Molecular Formula | C22H33ClNO2+ |
| Molecular Weight | 378.96 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | butyl 2-[1-[(E)-4-(2-chlorophenyl)-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate |
| SMILES | CCCCOC(=O)C[N+]1(C/C=C(\C)Cc2ccccc2Cl)CCCCC1 |
| InChI | InChI=1S/C22H33ClNO2/c1-3-4-16-26-22(25)18-24(13-8-5-9-14-24)15-12-19(2)17-20-10-6-7-11-21(20)23/h6-7,10-12H,3-5,8-9,13-18H2,1-2H3/q+1/b19-12+ |
| InChIKey | IMTPVGMVIJWXBP-XDHOZWIPSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.96 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|