C50H78Cl2N2O4 — CID 24842810
heptyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-heptoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate dichloride (PubChem CID 24842810) has the molecular formula C50H78Cl2N2O4 and a molecular weight of 842.09 g/mol. Its IUPAC name is heptyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-heptoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate dichloride.
| Compound Name | heptyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-heptoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate dichloride |
|---|---|
| PubChem CID | 24842810 |
| Molecular Formula | C50H78Cl2N2O4 |
| Molecular Weight | 842.09 g/mol |
| Exact Mass | 840.53 |
| IUPAC Name | heptyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-heptoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate dichloride |
| SMILES | CCCCCCCOC(=O)C[N+]1(C/C=C(/C)Cc2ccc(-c3ccc(C/C(C)=C\C[N+]4(CC(=O)OCCCCCCC)CCCCC4)cc3)cc2)CCCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C50H78N2O4.2ClH/c1-5-7-9-11-19-37-55-49(53)41-51(31-15-13-16-32-51)35-29-43(3)39-45-21-25-47(26-22-45)48-27-23-46(24-28-48)40-44(4)30-36-52(33-17-14-18-34-52)42-50(54)56-38-20-12-10-8-6-2;;/h21-30H,5-20,31-42H2,1-4H3;2*1H/q+2;;/p-2/b43-29-,44-30-;; |
| InChIKey | MHJUMHFGOGHVBX-JWNNJYPDSA-L |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.09 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|