C48H74N2O4+2 — CID 24842813
hexyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-hexoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate (PubChem CID 24842813) has the molecular formula C48H74N2O4+2 and a molecular weight of 743.13 g/mol. Its IUPAC name is hexyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-hexoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate.
| Compound Name | hexyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-hexoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 24842813 |
| Molecular Formula | C48H74N2O4+2 |
| Molecular Weight | 743.13 g/mol |
| Exact Mass | 742.56 |
| IUPAC Name | hexyl 2-[1-[(Z)-4-[4-[4-[(Z)-4-[1-(2-hexoxy-2-oxoethyl)piperidin-1-ium-1-yl]-2-methylbut-2-enyl]phenyl]phenyl]-3-methylbut-2-enyl]piperidin-1-ium-1-yl]acetate |
| SMILES | CCCCCCOC(=O)C[N+]1(C/C=C(/C)Cc2ccc(-c3ccc(C/C(C)=C\C[N+]4(CC(=O)OCCCCCC)CCCCC4)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C48H74N2O4/c1-5-7-9-17-35-53-47(51)39-49(29-13-11-14-30-49)33-27-41(3)37-43-19-23-45(24-20-43)46-25-21-44(22-26-46)38-42(4)28-34-50(31-15-12-16-32-50)40-48(52)54-36-18-10-8-6-2/h19-28H,5-18,29-40H2,1-4H3/q+2/b41-27-,42-28- |
| InChIKey | RCBAHOVGYZFWMS-HEPSPIFKSA-N |
| XLogP | 10.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.13 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|