C22H34NO2+ — CID 6444861
butyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate (PubChem CID 6444861) has the molecular formula C22H34NO2+ and a molecular weight of 344.52 g/mol. Its IUPAC name is butyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate.
| Compound Name | butyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 6444861 |
| Molecular Formula | C22H34NO2+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | butyl 2-[1-[(E)-3-methyl-4-phenylbut-2-enyl]piperidin-1-ium-1-yl]acetate |
| SMILES | CCCCOC(=O)C[N+]1(C/C=C(\C)Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H34NO2/c1-3-4-17-25-22(24)19-23(14-9-6-10-15-23)16-13-20(2)18-21-11-7-5-8-12-21/h5,7-8,11-13H,3-4,6,9-10,14-19H2,1-2H3/q+1/b20-13+ |
| InChIKey | NEJMZUZEPIPKRC-DEDYPNTBSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|