C46H70Cl2N2O4 — CID 24842818
pentyl 2-[1-[(Z)-3-methyl-4-[4-[4-[(Z)-2-methyl-4-[1-(2-oxo-2-pentoxyethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate dichloride (PubChem CID 24842818) has the molecular formula C46H70Cl2N2O4 and a molecular weight of 785.98 g/mol. Its IUPAC name is pentyl 2-[1-[(Z)-3-methyl-4-[4-[4-[(Z)-2-methyl-4-[1-(2-oxo-2-pentoxyethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate dichloride.
| Compound Name | pentyl 2-[1-[(Z)-3-methyl-4-[4-[4-[(Z)-2-methyl-4-[1-(2-oxo-2-pentoxyethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate dichloride |
|---|---|
| PubChem CID | 24842818 |
| Molecular Formula | C46H70Cl2N2O4 |
| Molecular Weight | 785.98 g/mol |
| Exact Mass | 784.47 |
| IUPAC Name | pentyl 2-[1-[(Z)-3-methyl-4-[4-[4-[(Z)-2-methyl-4-[1-(2-oxo-2-pentoxyethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate dichloride |
| SMILES | CCCCCOC(=O)C[N+]1(C/C=C(/C)Cc2ccc(-c3ccc(C/C(C)=C\C[N+]4(CC(=O)OCCCCC)CCCCC4)cc3)cc2)CCCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C46H70N2O4.2ClH/c1-5-7-15-33-51-45(49)37-47(27-11-9-12-28-47)31-25-39(3)35-41-17-21-43(22-18-41)44-23-19-42(20-24-44)36-40(4)26-32-48(29-13-10-14-30-48)38-46(50)52-34-16-8-6-2;;/h17-26H,5-16,27-38H2,1-4H3;2*1H/q+2;;/p-2/b39-25-,40-26-;; |
| InChIKey | ZVHGWGYTKWOGAW-IYVWAESHSA-L |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.98 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|