C52H82N2O4+2 — CID 6446238
octyl 2-[1-[(E)-3-methyl-4-[4-[4-[(E)-2-methyl-4-[1-(2-octoxy-2-oxoethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate (PubChem CID 6446238) has the molecular formula C52H82N2O4+2 and a molecular weight of 799.24 g/mol. Its IUPAC name is octyl 2-[1-[(E)-3-methyl-4-[4-[4-[(E)-2-methyl-4-[1-(2-octoxy-2-oxoethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate.
| Compound Name | octyl 2-[1-[(E)-3-methyl-4-[4-[4-[(E)-2-methyl-4-[1-(2-octoxy-2-oxoethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 6446238 |
| Molecular Formula | C52H82N2O4+2 |
| Molecular Weight | 799.24 g/mol |
| Exact Mass | 798.63 |
| IUPAC Name | octyl 2-[1-[(E)-3-methyl-4-[4-[4-[(E)-2-methyl-4-[1-(2-octoxy-2-oxoethyl)piperidin-1-ium-1-yl]but-2-enyl]phenyl]phenyl]but-2-enyl]piperidin-1-ium-1-yl]acetate |
| SMILES | CCCCCCCCOC(=O)C[N+]1(C/C=C(\C)Cc2ccc(-c3ccc(C/C(C)=C/C[N+]4(CC(=O)OCCCCCCCC)CCCCC4)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C52H82N2O4/c1-5-7-9-11-13-21-39-57-51(55)43-53(33-17-15-18-34-53)37-31-45(3)41-47-23-27-49(28-24-47)50-29-25-48(26-30-50)42-46(4)32-38-54(35-19-16-20-36-54)44-52(56)58-40-22-14-12-10-8-6-2/h23-32H,5-22,33-44H2,1-4H3/q+2/b45-31+,46-32+ |
| InChIKey | CVXLPZQFXXPOPA-RQAFMBFTSA-N |
| XLogP | 12.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.24 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|