C29H48NO2+ — CID 6446359
decyl 2-[1-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate (PubChem CID 6446359) has the molecular formula C29H48NO2+ and a molecular weight of 442.71 g/mol. Its IUPAC name is decyl 2-[1-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate.
| Compound Name | decyl 2-[1-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 6446359 |
| Molecular Formula | C29H48NO2+ |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.37 |
| IUPAC Name | decyl 2-[1-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)C[N+]1(C/C=C(\C)Cc2ccc(C)cc2)CCCCC1 |
| InChI | InChI=1S/C29H48NO2/c1-4-5-6-7-8-9-10-14-23-32-29(31)25-30(20-12-11-13-21-30)22-19-27(3)24-28-17-15-26(2)16-18-28/h15-19H,4-14,20-25H2,1-3H3/q+1/b27-19+ |
| InChIKey | GEBQBMJWSVIEPC-ZXVVBBHZSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|