C28H45ClNO3+ — CID 6912225
decyl 2-[1-[(Z)-3-chloro-4-(4-methoxyphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate (PubChem CID 6912225) has the molecular formula C28H45ClNO3+ and a molecular weight of 479.13 g/mol. Its IUPAC name is decyl 2-[1-[(Z)-3-chloro-4-(4-methoxyphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate.
| Compound Name | decyl 2-[1-[(Z)-3-chloro-4-(4-methoxyphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 6912225 |
| Molecular Formula | C28H45ClNO3+ |
| Molecular Weight | 479.13 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | decyl 2-[1-[(Z)-3-chloro-4-(4-methoxyphenyl)but-2-enyl]piperidin-1-ium-1-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)C[N+]1(C/C=C(\Cl)Cc2ccc(OC)cc2)CCCCC1 |
| InChI | InChI=1S/C28H45ClNO3/c1-3-4-5-6-7-8-9-13-22-33-28(31)24-30(19-11-10-12-20-30)21-18-26(29)23-25-14-16-27(32-2)17-15-25/h14-18H,3-13,19-24H2,1-2H3/q+1/b26-18- |
| InChIKey | XDAASMVHGXVHHJ-ITYLOYPMSA-N |
| XLogP | 7.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.13 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|