C28H48NO2+ — CID 6434710
(2-decoxy-2-oxoethyl)-diethyl-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]azanium (PubChem CID 6434710) has the molecular formula C28H48NO2+ and a molecular weight of 430.70 g/mol. Its IUPAC name is (2-decoxy-2-oxoethyl)-diethyl-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]azanium.
| Compound Name | (2-decoxy-2-oxoethyl)-diethyl-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]azanium |
|---|---|
| PubChem CID | 6434710 |
| Molecular Formula | C28H48NO2+ |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | (2-decoxy-2-oxoethyl)-diethyl-[(E)-3-methyl-4-(4-methylphenyl)but-2-enyl]azanium |
| SMILES | CCCCCCCCCCOC(=O)C[N+](CC)(CC)C/C=C(\C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C28H48NO2/c1-6-9-10-11-12-13-14-15-22-31-28(30)24-29(7-2,8-3)21-20-26(5)23-27-18-16-25(4)17-19-27/h16-20H,6-15,21-24H2,1-5H3/q+1/b26-20+ |
| InChIKey | CZJREDVPSJHAKT-LHLOQNFPSA-N |
| XLogP | 7.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|