C16H22O6 — CID 145217294
3-[2,3-dimethyl-4-(4-methyl-2,5-dioxooxolan-3-yl)butyl]-4-methyloxolane-2,5-dione (PubChem CID 145217294) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-[2,3-dimethyl-4-(4-methyl-2,5-dioxooxolan-3-yl)butyl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[2,3-dimethyl-4-(4-methyl-2,5-dioxooxolan-3-yl)butyl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 145217294 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[2,3-dimethyl-4-(4-methyl-2,5-dioxooxolan-3-yl)butyl]-4-methyloxolane-2,5-dione |
| SMILES | CC(CC1C(=O)OC(=O)C1C)C(C)CC1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C16H22O6/c1-7(5-11-9(3)13(17)21-15(11)19)8(2)6-12-10(4)14(18)22-16(12)20/h7-12H,5-6H2,1-4H3 |
| InChIKey | JTFMWRPIXUBUEM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|