C14H16O3 — CID 21351325
3-methyl-4-(2-phenylpropyl)oxolane-2,5-dione (PubChem CID 21351325) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-methyl-4-(2-phenylpropyl)oxolane-2,5-dione.
| Compound Name | 3-methyl-4-(2-phenylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 21351325 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-methyl-4-(2-phenylpropyl)oxolane-2,5-dione |
| SMILES | CC(CC1C(=O)OC(=O)C1C)c1ccccc1 |
| InChI | InChI=1S/C14H16O3/c1-9(11-6-4-3-5-7-11)8-12-10(2)13(15)17-14(12)16/h3-7,9-10,12H,8H2,1-2H3 |
| InChIKey | GZZSBQIOPFZIFW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|