C22H24O3 — CID 21344826
3,4-bis(2-phenylpropyl)oxolane-2,5-dione (PubChem CID 21344826) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3,4-bis(2-phenylpropyl)oxolane-2,5-dione.
| Compound Name | 3,4-bis(2-phenylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 21344826 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3,4-bis(2-phenylpropyl)oxolane-2,5-dione |
| SMILES | CC(CC1C(=O)OC(=O)C1CC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24O3/c1-15(17-9-5-3-6-10-17)13-19-20(22(24)25-21(19)23)14-16(2)18-11-7-4-8-12-18/h3-12,15-16,19-20H,13-14H2,1-2H3 |
| InChIKey | LJRQBCVDHKRCOO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|